C15H20ClN3OS — CID 122180116
N-(2-amino-4a,5,6,7,8,8a-hexahydro-4H-3,1-benzothiazin-6-yl)benzamide;hydrochloride (PubChem CID 122180116) has the molecular formula C15H20ClN3OS and a molecular weight of 325.87 g/mol. Its IUPAC name is N-(2-amino-4a,5,6,7,8,8a-hexahydro-4H-3,1-benzothiazin-6-yl)benzamide;hydrochloride.
| Compound Name | N-(2-amino-4a,5,6,7,8,8a-hexahydro-4H-3,1-benzothiazin-6-yl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 122180116 |
| Molecular Formula | C15H20ClN3OS |
| Molecular Weight | 325.87 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | N-(2-amino-4a,5,6,7,8,8a-hexahydro-4H-3,1-benzothiazin-6-yl)benzamide;hydrochloride |
| SMILES | Cl.NC1=NC2CCC(NC(=O)c3ccccc3)CC2CS1 |
| InChI | InChI=1S/C15H19N3OS.ClH/c16-15-18-13-7-6-12(8-11(13)9-20-15)17-14(19)10-4-2-1-3-5-10;/h1-5,11-13H,6-9H2,(H2,16,18)(H,17,19);1H |
| InChIKey | IIDCHWRBJOMJAY-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.87 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |