C18H21NO3 — CID 118915575
[3-[(2R)-6-phenylhexan-2-yl]-2-pyridinyl] hydrogen carbonate (PubChem CID 118915575) has the molecular formula C18H21NO3 and a molecular weight of 299.37 g/mol. Its IUPAC name is [3-[(2R)-6-phenylhexan-2-yl]-2-pyridinyl] hydrogen carbonate.
| Compound Name | [3-[(2R)-6-phenylhexan-2-yl]-2-pyridinyl] hydrogen carbonate |
|---|---|
| PubChem CID | 118915575 |
| Molecular Formula | C18H21NO3 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | [3-[(2R)-6-phenylhexan-2-yl]-2-pyridinyl] hydrogen carbonate |
| SMILES | C[C@H](CCCCc1ccccc1)c1cccnc1OC(=O)O |
| InChI | InChI=1S/C18H21NO3/c1-14(8-5-6-11-15-9-3-2-4-10-15)16-12-7-13-19-17(16)22-18(20)21/h2-4,7,9-10,12-14H,5-6,8,11H2,1H3,(H,20,21)/t14-/m1/s1 |
| InChIKey | FOFNRSVJLQKANM-CQSZACIVSA-N |
| XLogP | 4.65 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|