About (3-sulfanyl-2-pyridinyl) hydrogen carbonate
(3-sulfanyl-2-pyridinyl) hydrogen carbonate (PubChem CID 68785765) has the molecular formula C6H5NO3S
and a molecular weight of 171.18 g/mol. Its IUPAC name is (3-sulfanyl-2-pyridinyl) hydrogen carbonate.
Molecular Properties
| Compound Name | (3-sulfanyl-2-pyridinyl) hydrogen carbonate |
| PubChem CID | 68785765 |
| Molecular Formula | C6H5NO3S |
| Molecular Weight | 171.18 g/mol |
| Exact Mass | 171.00 |
| IUPAC Name | (3-sulfanyl-2-pyridinyl) hydrogen carbonate |
| SMILES | O=C(O)Oc1ncccc1S |
| InChI | InChI=1S/C6H5NO3S/c8-6(9)10-5-4(11)2-1-3-7-5/h1-3,11H,(H,8,9) |
| InChIKey | JYPIXTZTOLZIJV-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.18 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (3-sulfanyl-2-pyridinyl) hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-sulfanyl-2-pyridinyl) hydrogen carbonate?
The IUPAC name of (3-sulfanyl-2-pyridinyl) hydrogen carbonate (CID 68785765) is (3-sulfanyl-2-pyridinyl) hydrogen carbonate.
What is the SMILES notation for (3-sulfanyl-2-pyridinyl) hydrogen carbonate?
The canonical SMILES for (3-sulfanyl-2-pyridinyl) hydrogen carbonate is O=C(O)Oc1ncccc1S.
What is the InChIKey of (3-sulfanyl-2-pyridinyl) hydrogen carbonate?
The InChIKey is JYPIXTZTOLZIJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5NO3S/c8-6(9)10-5-4(11)2-1-3-7-5/h1-3,11H,(H,8,9).
What are the key properties of (3-sulfanyl-2-pyridinyl) hydrogen carbonate?
(3-sulfanyl-2-pyridinyl) hydrogen carbonate has a molecular weight of 171.18 g/mol, XLogP of 1.43, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-sulfanyl-2-pyridinyl) hydrogen carbonate is sourced from PubChem (CID 68785765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).