About (3-methoxy-2-pyridinyl) hydrogen carbonate;hydrochloride
(3-methoxy-2-pyridinyl) hydrogen carbonate;hydrochloride (PubChem CID 22363173) has the molecular formula C7H8ClNO4
and a molecular weight of 205.60 g/mol. Its IUPAC name is (3-methoxy-2-pyridinyl) hydrogen carbonate;hydrochloride.
Molecular Properties
| Compound Name | (3-methoxy-2-pyridinyl) hydrogen carbonate;hydrochloride |
| PubChem CID | 22363173 |
| Molecular Formula | C7H8ClNO4 |
| Molecular Weight | 205.60 g/mol |
| Exact Mass | 205.01 |
| IUPAC Name | (3-methoxy-2-pyridinyl) hydrogen carbonate;hydrochloride |
| SMILES | COc1cccnc1OC(=O)O.Cl |
| InChI | InChI=1S/C7H7NO4.ClH/c1-11-5-3-2-4-8-6(5)12-7(9)10;/h2-4H,1H3,(H,9,10);1H |
| InChIKey | NODLMFXNPOHZSF-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.60 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3-methoxy-2-pyridinyl) hydrogen carbonate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methoxy-2-pyridinyl) hydrogen carbonate;hydrochloride?
The IUPAC name of (3-methoxy-2-pyridinyl) hydrogen carbonate;hydrochloride (CID 22363173) is (3-methoxy-2-pyridinyl) hydrogen carbonate;hydrochloride.
What is the SMILES notation for (3-methoxy-2-pyridinyl) hydrogen carbonate;hydrochloride?
The canonical SMILES for (3-methoxy-2-pyridinyl) hydrogen carbonate;hydrochloride is COc1cccnc1OC(=O)O.Cl.
What is the InChIKey of (3-methoxy-2-pyridinyl) hydrogen carbonate;hydrochloride?
The InChIKey is NODLMFXNPOHZSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO4.ClH/c1-11-5-3-2-4-8-6(5)12-7(9)10;/h2-4H,1H3,(H,9,10);1H.
What are the key properties of (3-methoxy-2-pyridinyl) hydrogen carbonate;hydrochloride?
(3-methoxy-2-pyridinyl) hydrogen carbonate;hydrochloride has a molecular weight of 205.60 g/mol, XLogP of 1.57, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methoxy-2-pyridinyl) hydrogen carbonate;hydrochloride is sourced from PubChem (CID 22363173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).