C24H22FIN4O5S — CID 118918605
1-[3-(ethylsulfonylmethyl)phenyl]-5-(2-fluoro-4-iodoanilino)-6,8-dimethylpyrido[4,3-d]pyrimidine-2,4,7-trione (PubChem CID 118918605) has the molecular formula C24H22FIN4O5S and a molecular weight of 624.43 g/mol. Its IUPAC name is 1-[3-(ethylsulfonylmethyl)phenyl]-5-(2-fluoro-4-iodoanilino)-6,8-dimethylpyrido[4,3-d]pyrimidine-2,4,7-trione.
| Compound Name | 1-[3-(ethylsulfonylmethyl)phenyl]-5-(2-fluoro-4-iodoanilino)-6,8-dimethylpyrido[4,3-d]pyrimidine-2,4,7-trione |
|---|---|
| PubChem CID | 118918605 |
| Molecular Formula | C24H22FIN4O5S |
| Molecular Weight | 624.43 g/mol |
| Exact Mass | 624.03 |
| IUPAC Name | 1-[3-(ethylsulfonylmethyl)phenyl]-5-(2-fluoro-4-iodoanilino)-6,8-dimethylpyrido[4,3-d]pyrimidine-2,4,7-trione |
| SMILES | CCS(=O)(=O)Cc1cccc(-n2c(=O)[nH]c(=O)c3c(Nc4ccc(I)cc4F)n(C)c(=O)c(C)c32)c1 |
| InChI | InChI=1S/C24H22FIN4O5S/c1-4-36(34,35)12-14-6-5-7-16(10-14)30-20-13(2)23(32)29(3)21(19(20)22(31)28-24(30)33)27-18-9-8-15(26)11-17(18)25/h5-11,27H,4,12H2,1-3H3,(H,28,31,33) |
| InChIKey | GBCGBQYXGIJJBZ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 123.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.43 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|