C19H16N6O4 — CID 118918643
2-(3-amino-5-methoxyanilino)-5-methyl-8-nitropyrimido[5,4-c]isoquinolin-6-one (PubChem CID 118918643) has the molecular formula C19H16N6O4 and a molecular weight of 392.38 g/mol. Its IUPAC name is 2-(3-amino-5-methoxyanilino)-5-methyl-8-nitropyrimido[5,4-c]isoquinolin-6-one.
| Compound Name | 2-(3-amino-5-methoxyanilino)-5-methyl-8-nitropyrimido[5,4-c]isoquinolin-6-one |
|---|---|
| PubChem CID | 118918643 |
| Molecular Formula | C19H16N6O4 |
| Molecular Weight | 392.38 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | 2-(3-amino-5-methoxyanilino)-5-methyl-8-nitropyrimido[5,4-c]isoquinolin-6-one |
| SMILES | COc1cc(N)cc(Nc2ncc3c(n2)c2ccc([N+](=O)[O-])cc2c(=O)n3C)c1 |
| InChI | InChI=1S/C19H16N6O4/c1-24-16-9-21-19(22-11-5-10(20)6-13(7-11)29-2)23-17(16)14-4-3-12(25(27)28)8-15(14)18(24)26/h3-9H,20H2,1-2H3,(H,21,22,23) |
| InChIKey | URICGLRJUOQKEQ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 138.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.38 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|