C20H14N6O4 — CID 118918621
3-[(9-methoxy-5-methyl-8-nitro-6-oxopyrimido[5,4-c]isoquinolin-2-yl)amino]benzonitrile (PubChem CID 118918621) has the molecular formula C20H14N6O4 and a molecular weight of 402.37 g/mol. Its IUPAC name is 3-[(9-methoxy-5-methyl-8-nitro-6-oxopyrimido[5,4-c]isoquinolin-2-yl)amino]benzonitrile.
| Compound Name | 3-[(9-methoxy-5-methyl-8-nitro-6-oxopyrimido[5,4-c]isoquinolin-2-yl)amino]benzonitrile |
|---|---|
| PubChem CID | 118918621 |
| Molecular Formula | C20H14N6O4 |
| Molecular Weight | 402.37 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | 3-[(9-methoxy-5-methyl-8-nitro-6-oxopyrimido[5,4-c]isoquinolin-2-yl)amino]benzonitrile |
| SMILES | COc1cc2c(cc1[N+](=O)[O-])c(=O)n(C)c1cnc(Nc3cccc(C#N)c3)nc21 |
| InChI | InChI=1S/C20H14N6O4/c1-25-16-10-22-20(23-12-5-3-4-11(6-12)9-21)24-18(16)13-8-17(30-2)15(26(28)29)7-14(13)19(25)27/h3-8,10H,1-2H3,(H,22,23,24) |
| InChIKey | NHPSTEFFXQXTNN-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 135.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.37 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|