C18H22N6O — CID 118931227
7-(2-azido-2-cyclohexylethyl)-10-methoxy-4,6,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2,4,9,11-pentaene (PubChem CID 118931227) has the molecular formula C18H22N6O and a molecular weight of 338.42 g/mol. Its IUPAC name is 7-(2-azido-2-cyclohexylethyl)-10-methoxy-4,6,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2,4,9,11-pentaene.
| Compound Name | 7-(2-azido-2-cyclohexylethyl)-10-methoxy-4,6,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2,4,9,11-pentaene |
|---|---|
| PubChem CID | 118931227 |
| Molecular Formula | C18H22N6O |
| Molecular Weight | 338.42 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | 7-(2-azido-2-cyclohexylethyl)-10-methoxy-4,6,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2,4,9,11-pentaene |
| SMILES | COc1ccc2c(n1)C(CC(N=[N+]=[N-])C1CCCCC1)n1cncc1-2 |
| InChI | InChI=1S/C18H22N6O/c1-25-17-8-7-13-16-10-20-11-24(16)15(18(13)21-17)9-14(22-23-19)12-5-3-2-4-6-12/h7-8,10-12,14-15H,2-6,9H2,1H3 |
| InChIKey | GRUQPBZZIXRBFG-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 88.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.42 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|