C10H27N2O6P2+ — CID 118933313
3-[bis(2-phosphonoethyl)amino]propyl-trimethylazanium (PubChem CID 118933313) has the molecular formula C10H27N2O6P2+ and a molecular weight of 333.28 g/mol. Its IUPAC name is 3-[bis(2-phosphonoethyl)amino]propyl-trimethylazanium.
| Compound Name | 3-[bis(2-phosphonoethyl)amino]propyl-trimethylazanium |
|---|---|
| PubChem CID | 118933313 |
| Molecular Formula | C10H27N2O6P2+ |
| Molecular Weight | 333.28 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | 3-[bis(2-phosphonoethyl)amino]propyl-trimethylazanium |
| SMILES | C[N+](C)(C)CCCN(CCP(=O)(O)O)CCP(=O)(O)O |
| InChI | InChI=1S/C10H26N2O6P2/c1-12(2,3)8-4-5-11(6-9-19(13,14)15)7-10-20(16,17)18/h4-10H2,1-3H3,(H3-,13,14,15,16,17,18)/p+1 |
| InChIKey | VPJKAQBEZCUWEI-UHFFFAOYSA-O |
| XLogP | -0.26 |
| TPSA | 118.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.28 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|