C5H14NO3P — CID 4242130
hydroxy-[2-(trimethylazaniumyl)ethyl]phosphinate (PubChem CID 4242130) has the molecular formula C5H14NO3P and a molecular weight of 167.15 g/mol. Its IUPAC name is hydroxy-[2-(trimethylazaniumyl)ethyl]phosphinate.
| Compound Name | hydroxy-[2-(trimethylazaniumyl)ethyl]phosphinate |
|---|---|
| PubChem CID | 4242130 |
| Molecular Formula | C5H14NO3P |
| Molecular Weight | 167.15 g/mol |
| Exact Mass | 167.07 |
| IUPAC Name | hydroxy-[2-(trimethylazaniumyl)ethyl]phosphinate |
| SMILES | C[N+](C)(C)CCP(=O)([O-])O |
| InChI | InChI=1S/C5H14NO3P/c1-6(2,3)4-5-10(7,8)9/h4-5H2,1-3H3,(H-,7,8,9) |
| InChIKey | VCANKBLUHKRQLL-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.15 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|