C7H14NO3P — CID 172696241
2-[dimethyl(prop-2-ynyl)azaniumyl]ethyl-hydroxyphosphinate (PubChem CID 172696241) has the molecular formula C7H14NO3P and a molecular weight of 191.17 g/mol. Its IUPAC name is 2-[dimethyl(prop-2-ynyl)azaniumyl]ethyl-hydroxyphosphinate.
| Compound Name | 2-[dimethyl(prop-2-ynyl)azaniumyl]ethyl-hydroxyphosphinate |
|---|---|
| PubChem CID | 172696241 |
| Molecular Formula | C7H14NO3P |
| Molecular Weight | 191.17 g/mol |
| Exact Mass | 191.07 |
| IUPAC Name | 2-[dimethyl(prop-2-ynyl)azaniumyl]ethyl-hydroxyphosphinate |
| SMILES | C#CC[N+](C)(C)CCP(=O)([O-])O |
| InChI | InChI=1S/C7H14NO3P/c1-4-5-8(2,3)6-7-12(9,10)11/h1H,5-7H2,2-3H3,(H-,9,10,11) |
| InChIKey | CIWORAALABKFCP-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.17 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|