C9H23IN2O6P2-2 — CID 23422714
2-[2-[dimethyl(2-phosphonatoethyl)azaniumyl]ethyl-methylazaniumyl]ethyl-hydroxyphosphinate iodide (PubChem CID 23422714) has the molecular formula C9H23IN2O6P2-2 and a molecular weight of 444.14 g/mol. Its IUPAC name is 2-[2-[dimethyl(2-phosphonatoethyl)azaniumyl]ethyl-methylazaniumyl]ethyl-hydroxyphosphinate iodide.
| Compound Name | 2-[2-[dimethyl(2-phosphonatoethyl)azaniumyl]ethyl-methylazaniumyl]ethyl-hydroxyphosphinate iodide |
|---|---|
| PubChem CID | 23422714 |
| Molecular Formula | C9H23IN2O6P2-2 |
| Molecular Weight | 444.14 g/mol |
| Exact Mass | 444.01 |
| IUPAC Name | 2-[2-[dimethyl(2-phosphonatoethyl)azaniumyl]ethyl-methylazaniumyl]ethyl-hydroxyphosphinate iodide |
| SMILES | C[NH+](CC[N+](C)(C)CCP(=O)([O-])[O-])CCP(=O)([O-])O.[I-] |
| InChI | InChI=1S/C9H24N2O6P2.HI/c1-10(5-8-18(12,13)14)4-6-11(2,3)7-9-19(15,16)17;/h4-9H2,1-3H3,(H3-,12,13,14,15,16,17);1H/p-2 |
| InChIKey | QIZOLHLUEDAZAN-UHFFFAOYSA-L |
| XLogP | -6.96 |
| TPSA | 127.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.14 |
| LogP ≤ 5 | -6.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|