C7H19NO8P2 — CID 90013651
2-[2-hydroxyethyl(2-phosphonoethyl)amino]ethoxymethylphosphonic acid (PubChem CID 90013651) has the molecular formula C7H19NO8P2 and a molecular weight of 307.18 g/mol. Its IUPAC name is 2-[2-hydroxyethyl(2-phosphonoethyl)amino]ethoxymethylphosphonic acid.
| Compound Name | 2-[2-hydroxyethyl(2-phosphonoethyl)amino]ethoxymethylphosphonic acid |
|---|---|
| PubChem CID | 90013651 |
| Molecular Formula | C7H19NO8P2 |
| Molecular Weight | 307.18 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | 2-[2-hydroxyethyl(2-phosphonoethyl)amino]ethoxymethylphosphonic acid |
| SMILES | O=P(O)(O)CCN(CCO)CCOCP(=O)(O)O |
| InChI | InChI=1S/C7H19NO8P2/c9-4-1-8(3-6-17(10,11)12)2-5-16-7-18(13,14)15/h9H,1-7H2,(H2,10,11,12)(H2,13,14,15) |
| InChIKey | RMLHQCNLHBQUOW-UHFFFAOYSA-N |
| XLogP | -1.39 |
| TPSA | 147.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.18 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|