C31H42N8O3 — CID 118936653
(2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-[2-methyl-2-[[3-[2-[6-(1-methylcyclobutyl)-1H-benzimidazol-2-yl]ethyl]cyclobutyl]amino]propyl]oxolane-3,4-diol (PubChem CID 118936653) has the molecular formula C31H42N8O3 and a molecular weight of 574.73 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-[2-methyl-2-[[3-[2-[6-(1-methylcyclobutyl)-1H-benzimidazol-2-yl]ethyl]cyclobutyl]amino]propyl]oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-[2-methyl-2-[[3-[2-[6-(1-methylcyclobutyl)-1H-benzimidazol-2-yl]ethyl]cyclobutyl]amino]propyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 118936653 |
| Molecular Formula | C31H42N8O3 |
| Molecular Weight | 574.73 g/mol |
| Exact Mass | 574.34 |
| IUPAC Name | (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-[2-methyl-2-[[3-[2-[6-(1-methylcyclobutyl)-1H-benzimidazol-2-yl]ethyl]cyclobutyl]amino]propyl]oxolane-3,4-diol |
| SMILES | CC(C)(C[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O)NC1CC(CCc2nc3ccc(C4(C)CCC4)cc3[nH]2)C1 |
| InChI | InChI=1S/C31H42N8O3/c1-30(2,14-22-25(40)26(41)29(42-22)39-16-35-24-27(32)33-15-34-28(24)39)38-19-11-17(12-19)5-8-23-36-20-7-6-18(13-21(20)37-23)31(3)9-4-10-31/h6-7,13,15-17,19,22,25-26,29,38,40-41H,4-5,8-12,14H2,1-3H3,(H,36,37)(H2,32,33,34)/t17?,19?,22-,25-,26-,29-/m1/s1 |
| InChIKey | NXCZDDFYSNRBDR-XKHGBIBOSA-N |
| XLogP | 3.52 |
| TPSA | 160.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.73 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |