C10H18N2O2S — CID 118950480
tert-butyl (2R)-2-methyl-3-sulfanylidenepiperazine-1-carboxylate (PubChem CID 118950480) has the molecular formula C10H18N2O2S and a molecular weight of 230.33 g/mol. Its IUPAC name is tert-butyl (2R)-2-methyl-3-sulfanylidenepiperazine-1-carboxylate.
| Compound Name | tert-butyl (2R)-2-methyl-3-sulfanylidenepiperazine-1-carboxylate |
|---|---|
| PubChem CID | 118950480 |
| Molecular Formula | C10H18N2O2S |
| Molecular Weight | 230.33 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | tert-butyl (2R)-2-methyl-3-sulfanylidenepiperazine-1-carboxylate |
| SMILES | C[C@@H]1C(=S)NCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H18N2O2S/c1-7-8(15)11-5-6-12(7)9(13)14-10(2,3)4/h7H,5-6H2,1-4H3,(H,11,15)/t7-/m1/s1 |
| InChIKey | IDEXIZAXWJPGMQ-SSDOTTSWSA-N |
| XLogP | 1.54 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.33 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|