C16H15N3O4 — CID 118951864
(4R,4aS,7aR,12bR)-4a,9-dinitroso-1,2,3,4,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one (PubChem CID 118951864) has the molecular formula C16H15N3O4 and a molecular weight of 313.31 g/mol. Its IUPAC name is (4R,4aS,7aR,12bR)-4a,9-dinitroso-1,2,3,4,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one.
| Compound Name | (4R,4aS,7aR,12bR)-4a,9-dinitroso-1,2,3,4,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one |
|---|---|
| PubChem CID | 118951864 |
| Molecular Formula | C16H15N3O4 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | (4R,4aS,7aR,12bR)-4a,9-dinitroso-1,2,3,4,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one |
| SMILES | O=Nc1ccc2c3c1O[C@H]1C(=O)CC[C@@]4(N=O)[C@@H](C2)NCC[C@]314 |
| InChI | InChI=1S/C16H15N3O4/c20-10-3-4-16(19-22)11-7-8-1-2-9(18-21)13-12(8)15(16,5-6-17-11)14(10)23-13/h1-2,11,14,17H,3-7H2/t11-,14+,15+,16-/m1/s1 |
| InChIKey | IKIRPSGMBAGSGX-IPOQPSJVSA-N |
| XLogP | 1.87 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |