C22H29N2O4+ — CID 129215147
cyclopropylmethyl-ethyl-[(1R,5S,6R,14S)-5-hydroxy-14-methyl-11-nitroso-2-oxo-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-8(13),9,11-trien-6-yl]-methylazanium (PubChem CID 129215147) has the molecular formula C22H29N2O4+ and a molecular weight of 385.48 g/mol. Its IUPAC name is cyclopropylmethyl-ethyl-[(1R,5S,6R,14S)-5-hydroxy-14-methyl-11-nitroso-2-oxo-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-8(13),9,11-trien-6-yl]-methylazanium.
| Compound Name | cyclopropylmethyl-ethyl-[(1R,5S,6R,14S)-5-hydroxy-14-methyl-11-nitroso-2-oxo-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-8(13),9,11-trien-6-yl]-methylazanium |
|---|---|
| PubChem CID | 129215147 |
| Molecular Formula | C22H29N2O4+ |
| Molecular Weight | 385.48 g/mol |
| Exact Mass | 385.21 |
| IUPAC Name | cyclopropylmethyl-ethyl-[(1R,5S,6R,14S)-5-hydroxy-14-methyl-11-nitroso-2-oxo-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-8(13),9,11-trien-6-yl]-methylazanium |
| SMILES | CC[N+](C)(CC1CC1)[C@@H]1Cc2ccc(N=O)c3c2[C@@]2(C)[C@@H](O3)C(=O)CC[C@@]12O |
| InChI | InChI=1S/C22H29N2O4/c1-4-24(3,12-13-5-6-13)17-11-14-7-8-15(23-27)19-18(14)21(2)20(28-19)16(25)9-10-22(17,21)26/h7-8,13,17,20,26H,4-6,9-12H2,1-3H3/q+1/t17-,20+,21+,22-,24?/m1/s1 |
| InChIKey | BHKNDXGLVROMRQ-LRCPVQSPSA-N |
| XLogP | 3.00 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.48 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|