C25H27NO3 — CID 68541638
(4R,4aS,12bS)-4a-(3-phenylpropoxy)-1,2,3,4,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one (PubChem CID 68541638) has the molecular formula C25H27NO3 and a molecular weight of 389.50 g/mol. Its IUPAC name is (4R,4aS,12bS)-4a-(3-phenylpropoxy)-1,2,3,4,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one.
| Compound Name | (4R,4aS,12bS)-4a-(3-phenylpropoxy)-1,2,3,4,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one |
|---|---|
| PubChem CID | 68541638 |
| Molecular Formula | C25H27NO3 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | (4R,4aS,12bS)-4a-(3-phenylpropoxy)-1,2,3,4,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one |
| SMILES | O=C1CC[C@@]2(OCCCc3ccccc3)[C@H]3Cc4cccc5c4[C@@]2(CCN3)C1O5 |
| InChI | InChI=1S/C25H27NO3/c27-19-11-12-25(28-15-5-8-17-6-2-1-3-7-17)21-16-18-9-4-10-20-22(18)24(25,13-14-26-21)23(19)29-20/h1-4,6-7,9-10,21,23,26H,5,8,11-16H2/t21-,23?,24+,25-/m1/s1 |
| InChIKey | LHXRRCLMUIHDCC-DVAINZFESA-N |
| XLogP | 3.35 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|