C29H35NO4 — CID 130291614
(1R,5S,6R,14S)-6-[ethyl(prop-2-enyl)amino]-11-hydroxy-14-methyl-5-(3-phenylpropoxy)-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-8(13),9,11-trien-2-one (PubChem CID 130291614) has the molecular formula C29H35NO4 and a molecular weight of 461.60 g/mol. Its IUPAC name is (1R,5S,6R,14S)-6-[ethyl(prop-2-enyl)amino]-11-hydroxy-14-methyl-5-(3-phenylpropoxy)-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-8(13),9,11-trien-2-one.
| Compound Name | (1R,5S,6R,14S)-6-[ethyl(prop-2-enyl)amino]-11-hydroxy-14-methyl-5-(3-phenylpropoxy)-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-8(13),9,11-trien-2-one |
|---|---|
| PubChem CID | 130291614 |
| Molecular Formula | C29H35NO4 |
| Molecular Weight | 461.60 g/mol |
| Exact Mass | 461.26 |
| IUPAC Name | (1R,5S,6R,14S)-6-[ethyl(prop-2-enyl)amino]-11-hydroxy-14-methyl-5-(3-phenylpropoxy)-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-8(13),9,11-trien-2-one |
| SMILES | C=CCN(CC)[C@@H]1Cc2ccc(O)c3c2[C@@]2(C)[C@@H](O3)C(=O)CC[C@@]12OCCCc1ccccc1 |
| InChI | InChI=1S/C29H35NO4/c1-4-17-30(5-2)24-19-21-13-14-22(31)26-25(21)28(3)27(34-26)23(32)15-16-29(24,28)33-18-9-12-20-10-7-6-8-11-20/h4,6-8,10-11,13-14,24,27,31H,1,5,9,12,15-19H2,2-3H3/t24-,27+,28+,29-/m1/s1 |
| InChIKey | SHAKACAWRCRUFC-ZLPBPMGLSA-N |
| XLogP | 4.59 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.60 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|