C24H22ClN5O3 — CID 118954975
[2-chloro-5-(7-morpholin-4-ylquinazolin-4-yl)phenyl]-(5-methoxypyrimidin-4-yl)methanol (PubChem CID 118954975) has the molecular formula C24H22ClN5O3 and a molecular weight of 463.93 g/mol. Its IUPAC name is [2-chloro-5-(7-morpholin-4-ylquinazolin-4-yl)phenyl]-(5-methoxypyrimidin-4-yl)methanol.
| Compound Name | [2-chloro-5-(7-morpholin-4-ylquinazolin-4-yl)phenyl]-(5-methoxypyrimidin-4-yl)methanol |
|---|---|
| PubChem CID | 118954975 |
| Molecular Formula | C24H22ClN5O3 |
| Molecular Weight | 463.93 g/mol |
| Exact Mass | 463.14 |
| IUPAC Name | [2-chloro-5-(7-morpholin-4-ylquinazolin-4-yl)phenyl]-(5-methoxypyrimidin-4-yl)methanol |
| SMILES | COc1cncnc1C(O)c1cc(-c2ncnc3cc(N4CCOCC4)ccc23)ccc1Cl |
| InChI | InChI=1S/C24H22ClN5O3/c1-32-21-12-26-13-28-23(21)24(31)18-10-15(2-5-19(18)25)22-17-4-3-16(11-20(17)27-14-29-22)30-6-8-33-9-7-30/h2-5,10-14,24,31H,6-9H2,1H3 |
| InChIKey | OTIHBNMSAHVGDN-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 93.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.93 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |