C27H27ClN4O3 — CID 123451851
[2-chloro-5-(7-morpholin-4-ylquinazolin-4-yl)phenyl]-[(4E,7E)-2-methoxy-3,6-dihydroazocin-5-yl]methanol (PubChem CID 123451851) has the molecular formula C27H27ClN4O3 and a molecular weight of 490.99 g/mol. Its IUPAC name is [2-chloro-5-(7-morpholin-4-ylquinazolin-4-yl)phenyl]-[(4E,7E)-2-methoxy-3,6-dihydroazocin-5-yl]methanol.
| Compound Name | [2-chloro-5-(7-morpholin-4-ylquinazolin-4-yl)phenyl]-[(4E,7E)-2-methoxy-3,6-dihydroazocin-5-yl]methanol |
|---|---|
| PubChem CID | 123451851 |
| Molecular Formula | C27H27ClN4O3 |
| Molecular Weight | 490.99 g/mol |
| Exact Mass | 490.18 |
| IUPAC Name | [2-chloro-5-(7-morpholin-4-ylquinazolin-4-yl)phenyl]-[(4E,7E)-2-methoxy-3,6-dihydroazocin-5-yl]methanol |
| SMILES | CO/C1=N/C=C\C/C(C(O)c2cc(-c3ncnc4cc(N5CCOCC5)ccc34)ccc2Cl)=C\C1 |
| InChI | InChI=1S/C27H27ClN4O3/c1-34-25-9-5-18(3-2-10-29-25)27(33)22-15-19(4-8-23(22)28)26-21-7-6-20(16-24(21)30-17-31-26)32-11-13-35-14-12-32/h2,4-8,10,15-17,27,33H,3,9,11-14H2,1H3/b10-2-,18-5+,29-25+ |
| InChIKey | VSHCWNDMWMMHPQ-QIRBBVRESA-N |
| XLogP | 5.10 |
| TPSA | 80.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.99 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|