C15H18N2O4S — CID 11895842
(1S,2S,3R,4R)-3-[[(3-methylthiophene-2-carbonyl)amino]carbamoyl]bicyclo[2.2.1]heptane-2-carboxylic acid (PubChem CID 11895842) has the molecular formula C15H18N2O4S and a molecular weight of 322.39 g/mol. Its IUPAC name is (1S,2S,3R,4R)-3-[[(3-methylthiophene-2-carbonyl)amino]carbamoyl]bicyclo[2.2.1]heptane-2-carboxylic acid.
| Compound Name | (1S,2S,3R,4R)-3-[[(3-methylthiophene-2-carbonyl)amino]carbamoyl]bicyclo[2.2.1]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 11895842 |
| Molecular Formula | C15H18N2O4S |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | (1S,2S,3R,4R)-3-[[(3-methylthiophene-2-carbonyl)amino]carbamoyl]bicyclo[2.2.1]heptane-2-carboxylic acid |
| SMILES | Cc1ccsc1C(=O)NNC(=O)[C@@H]1[C@@H]2CC[C@@H](C2)[C@@H]1C(=O)O |
| InChI | InChI=1S/C15H18N2O4S/c1-7-4-5-22-12(7)14(19)17-16-13(18)10-8-2-3-9(6-8)11(10)15(20)21/h4-5,8-11H,2-3,6H2,1H3,(H,16,18)(H,17,19)(H,20,21)/t8-,9+,10-,11+/m1/s1 |
| InChIKey | SRUGCRNUVIHRLB-YTWAJWBKSA-N |
| XLogP | 1.56 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|