C19H17F2N5O3S — CID 118960814
2-[5-(4,4-difluorocyclohexylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]-N-[4-(1H-1,2,4-triazol-5-yl)phenyl]acetamide (PubChem CID 118960814) has the molecular formula C19H17F2N5O3S and a molecular weight of 433.44 g/mol. Its IUPAC name is 2-[5-(4,4-difluorocyclohexylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]-N-[4-(1H-1,2,4-triazol-5-yl)phenyl]acetamide.
| Compound Name | 2-[5-(4,4-difluorocyclohexylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]-N-[4-(1H-1,2,4-triazol-5-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 118960814 |
| Molecular Formula | C19H17F2N5O3S |
| Molecular Weight | 433.44 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | 2-[5-(4,4-difluorocyclohexylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]-N-[4-(1H-1,2,4-triazol-5-yl)phenyl]acetamide |
| SMILES | O=C(CN1C(=O)SC(=C2CCC(F)(F)CC2)C1=O)Nc1ccc(-c2ncn[nH]2)cc1 |
| InChI | InChI=1S/C19H17F2N5O3S/c20-19(21)7-5-11(6-8-19)15-17(28)26(18(29)30-15)9-14(27)24-13-3-1-12(2-4-13)16-22-10-23-25-16/h1-4,10H,5-9H2,(H,24,27)(H,22,23,25) |
| InChIKey | PWHIKSYFXVLKEQ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.44 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|