C18H17ClN4O5S2 — CID 171431832
2-[5-(4-chloro-4-isocyanocyclohexylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-sulfamoylphenyl)acetamide (PubChem CID 171431832) has the molecular formula C18H17ClN4O5S2 and a molecular weight of 468.94 g/mol. Its IUPAC name is 2-[5-(4-chloro-4-isocyanocyclohexylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-sulfamoylphenyl)acetamide.
| Compound Name | 2-[5-(4-chloro-4-isocyanocyclohexylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 171431832 |
| Molecular Formula | C18H17ClN4O5S2 |
| Molecular Weight | 468.94 g/mol |
| Exact Mass | 468.03 |
| IUPAC Name | 2-[5-(4-chloro-4-isocyanocyclohexylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-sulfamoylphenyl)acetamide |
| SMILES | [C-]#[N+]C1(Cl)CCC(=C2SC(=O)N(CC(=O)Nc3ccc(S(N)(=O)=O)cc3)C2=O)CC1 |
| InChI | InChI=1S/C18H17ClN4O5S2/c1-21-18(19)8-6-11(7-9-18)15-16(25)23(17(26)29-15)10-14(24)22-12-2-4-13(5-3-12)30(20,27)28/h2-5H,6-10H2,(H,22,24)(H2,20,27,28)/b15-11- |
| InChIKey | FVWUMKFETIQFQZ-PTNGSMBKSA-N |
| XLogP | 2.65 |
| TPSA | 131.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.94 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|