C17H17Cl2N3O3S2 — CID 145048853
N-(4-aminosulfanylphenyl)-2-[5-(4,4-dichlorocyclohexylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide (PubChem CID 145048853) has the molecular formula C17H17Cl2N3O3S2 and a molecular weight of 446.38 g/mol. Its IUPAC name is N-(4-aminosulfanylphenyl)-2-[5-(4,4-dichlorocyclohexylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | N-(4-aminosulfanylphenyl)-2-[5-(4,4-dichlorocyclohexylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 145048853 |
| Molecular Formula | C17H17Cl2N3O3S2 |
| Molecular Weight | 446.38 g/mol |
| Exact Mass | 445.01 |
| IUPAC Name | N-(4-aminosulfanylphenyl)-2-[5-(4,4-dichlorocyclohexylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
| SMILES | NSc1ccc(NC(=O)CN2C(=O)SC(=C3CCC(Cl)(Cl)CC3)C2=O)cc1 |
| InChI | InChI=1S/C17H17Cl2N3O3S2/c18-17(19)7-5-10(6-8-17)14-15(24)22(16(25)26-14)9-13(23)21-11-1-3-12(27-20)4-2-11/h1-4H,5-9,20H2,(H,21,23) |
| InChIKey | YSFMBJVTZRXNIQ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.38 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|