C31H49NO4 — CID 118963577
(1S,2R,5S,6S,10S,13R,14S,20S)-7,13,14-trihydroxy-20-(hydroxymethyl)-1,2,6,10,17,17,20-heptamethyltetracyclo[12.8.0.02,11.05,10]docosa-7,11-diene-8-carbonitrile (PubChem CID 118963577) has the molecular formula C31H49NO4 and a molecular weight of 499.74 g/mol. Its IUPAC name is (1S,2R,5S,6S,10S,13R,14S,20S)-7,13,14-trihydroxy-20-(hydroxymethyl)-1,2,6,10,17,17,20-heptamethyltetracyclo[12.8.0.02,11.05,10]docosa-7,11-diene-8-carbonitrile.
| Compound Name | (1S,2R,5S,6S,10S,13R,14S,20S)-7,13,14-trihydroxy-20-(hydroxymethyl)-1,2,6,10,17,17,20-heptamethyltetracyclo[12.8.0.02,11.05,10]docosa-7,11-diene-8-carbonitrile |
|---|---|
| PubChem CID | 118963577 |
| Molecular Formula | C31H49NO4 |
| Molecular Weight | 499.74 g/mol |
| Exact Mass | 499.37 |
| IUPAC Name | (1S,2R,5S,6S,10S,13R,14S,20S)-7,13,14-trihydroxy-20-(hydroxymethyl)-1,2,6,10,17,17,20-heptamethyltetracyclo[12.8.0.02,11.05,10]docosa-7,11-diene-8-carbonitrile |
| SMILES | C[C@@H]1C(O)=C(C#N)C[C@]2(C)C3=C[C@@H](O)[C@]4(O)CCC(C)(C)CC[C@](C)(CO)CC[C@@]4(C)[C@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C31H49NO4/c1-20-22-8-9-29(6)23(28(22,5)17-21(18-32)25(20)35)16-24(34)31(36)15-11-26(2,3)10-12-27(4,19-33)13-14-30(29,31)7/h16,20,22,24,33-36H,8-15,17,19H2,1-7H3/t20-,22-,24+,27-,28-,29+,30-,31+/m0/s1 |
| InChIKey | GUJVEVMCQZSASG-DYPHLYEZSA-N |
| XLogP | 6.20 |
| TPSA | 104.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.74 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|