C19H37N3O2 — CID 11896621
N-[3-(diethylamino)propyl]-N'-[(1R,2S,3S)-2,3-dimethylcyclohexyl]butanediamide (PubChem CID 11896621) has the molecular formula C19H37N3O2 and a molecular weight of 339.52 g/mol. Its IUPAC name is N-[3-(diethylamino)propyl]-N'-[(1R,2S,3S)-2,3-dimethylcyclohexyl]butanediamide.
| Compound Name | N-[3-(diethylamino)propyl]-N'-[(1R,2S,3S)-2,3-dimethylcyclohexyl]butanediamide |
|---|---|
| PubChem CID | 11896621 |
| Molecular Formula | C19H37N3O2 |
| Molecular Weight | 339.52 g/mol |
| Exact Mass | 339.29 |
| IUPAC Name | N-[3-(diethylamino)propyl]-N'-[(1R,2S,3S)-2,3-dimethylcyclohexyl]butanediamide |
| SMILES | CCN(CC)CCCNC(=O)CCC(=O)N[C@@H]1CCC[C@H](C)[C@@H]1C |
| InChI | InChI=1S/C19H37N3O2/c1-5-22(6-2)14-8-13-20-18(23)11-12-19(24)21-17-10-7-9-15(3)16(17)4/h15-17H,5-14H2,1-4H3,(H,20,23)(H,21,24)/t15-,16-,17+/m0/s1 |
| InChIKey | WRLNKECLCIJXHK-YESZJQIVSA-N |
| XLogP | 2.56 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.52 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|