C26H36ClN6O8P — CID 118966212
[(2S)-2-[[[(2R,3R,4R,5R)-5-(2-amino-6-ethoxypurin-9-yl)-4-chloro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propyl] 2-methylpropanoate (PubChem CID 118966212) has the molecular formula C26H36ClN6O8P and a molecular weight of 627.04 g/mol. Its IUPAC name is [(2S)-2-[[[(2R,3R,4R,5R)-5-(2-amino-6-ethoxypurin-9-yl)-4-chloro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propyl] 2-methylpropanoate.
| Compound Name | [(2S)-2-[[[(2R,3R,4R,5R)-5-(2-amino-6-ethoxypurin-9-yl)-4-chloro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propyl] 2-methylpropanoate |
|---|---|
| PubChem CID | 118966212 |
| Molecular Formula | C26H36ClN6O8P |
| Molecular Weight | 627.04 g/mol |
| Exact Mass | 626.20 |
| IUPAC Name | [(2S)-2-[[[(2R,3R,4R,5R)-5-(2-amino-6-ethoxypurin-9-yl)-4-chloro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propyl] 2-methylpropanoate |
| SMILES | CCOc1nc(N)nc2c1ncn2[C@@H]1O[C@H](CO[P@](=O)(N[C@@H](C)COC(=O)C(C)C)Oc2ccccc2)[C@@H](O)[C@@]1(C)Cl |
| InChI | InChI=1S/C26H36ClN6O8P/c1-6-37-22-19-21(30-25(28)31-22)33(14-29-19)24-26(5,27)20(34)18(40-24)13-39-42(36,41-17-10-8-7-9-11-17)32-16(4)12-38-23(35)15(2)3/h7-11,14-16,18,20,24,34H,6,12-13H2,1-5H3,(H,32,36)(H2,28,30,31)/t16-,18+,20+,24+,26+,42+/m0/s1 |
| InChIKey | RBMUDJPEJRCPLI-MRTUVEEPSA-N |
| XLogP | 3.44 |
| TPSA | 182.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.04 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|