C31H32Cl2N4O5 — CID 118967635
[2,6-dichloro-4-(pyrrolidin-1-ylmethyl)phenyl] 4-[4-[(3-methoxycarbonylbenzoyl)amino]phenyl]piperazine-1-carboxylate (PubChem CID 118967635) has the molecular formula C31H32Cl2N4O5 and a molecular weight of 611.53 g/mol. Its IUPAC name is [2,6-dichloro-4-(pyrrolidin-1-ylmethyl)phenyl] 4-[4-[(3-methoxycarbonylbenzoyl)amino]phenyl]piperazine-1-carboxylate.
| Compound Name | [2,6-dichloro-4-(pyrrolidin-1-ylmethyl)phenyl] 4-[4-[(3-methoxycarbonylbenzoyl)amino]phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 118967635 |
| Molecular Formula | C31H32Cl2N4O5 |
| Molecular Weight | 611.53 g/mol |
| Exact Mass | 610.17 |
| IUPAC Name | [2,6-dichloro-4-(pyrrolidin-1-ylmethyl)phenyl] 4-[4-[(3-methoxycarbonylbenzoyl)amino]phenyl]piperazine-1-carboxylate |
| SMILES | COC(=O)c1cccc(C(=O)Nc2ccc(N3CCN(C(=O)Oc4c(Cl)cc(CN5CCCC5)cc4Cl)CC3)cc2)c1 |
| InChI | InChI=1S/C31H32Cl2N4O5/c1-41-30(39)23-6-4-5-22(19-23)29(38)34-24-7-9-25(10-8-24)36-13-15-37(16-14-36)31(40)42-28-26(32)17-21(18-27(28)33)20-35-11-2-3-12-35/h4-10,17-19H,2-3,11-16,20H2,1H3,(H,34,38) |
| InChIKey | HTVLVNALSABTBZ-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.53 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|