C26H30ClIN3O9P — CID 118970461
propan-2-yl (2R)-2-[[[(2R,3R,4R)-4-chloro-3-hydroxy-5-(5-iodo-2,4-dioxopyrimidin-1-yl)-4-methyloxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate (PubChem CID 118970461) has the molecular formula C26H30ClIN3O9P and a molecular weight of 721.87 g/mol. Its IUPAC name is propan-2-yl (2R)-2-[[[(2R,3R,4R)-4-chloro-3-hydroxy-5-(5-iodo-2,4-dioxopyrimidin-1-yl)-4-methyloxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2R)-2-[[[(2R,3R,4R)-4-chloro-3-hydroxy-5-(5-iodo-2,4-dioxopyrimidin-1-yl)-4-methyloxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 118970461 |
| Molecular Formula | C26H30ClIN3O9P |
| Molecular Weight | 721.87 g/mol |
| Exact Mass | 721.05 |
| IUPAC Name | propan-2-yl (2R)-2-[[[(2R,3R,4R)-4-chloro-3-hydroxy-5-(5-iodo-2,4-dioxopyrimidin-1-yl)-4-methyloxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate |
| SMILES | CC(C)OC(=O)[C@@H](C)N[P@@](=O)(OC[C@H]1OC(n2cc(I)c(=O)[nH]c2=O)[C@](C)(Cl)[C@@H]1O)Oc1cccc2ccccc12 |
| InChI | InChI=1S/C26H30ClIN3O9P/c1-14(2)38-23(34)15(3)30-41(36,40-19-11-7-9-16-8-5-6-10-17(16)19)37-13-20-21(32)26(4,27)24(39-20)31-12-18(28)22(33)29-25(31)35/h5-12,14-15,20-21,24,32H,13H2,1-4H3,(H,30,36)(H,29,33,35)/t15-,20-,21-,24?,26-,41-/m1/s1 |
| InChIKey | RJBNVFVVRWOYRB-XCTBMDSFSA-N |
| XLogP | 3.68 |
| TPSA | 158.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.87 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|