C11H8Cl2N2O3S — CID 118975317
2-acetamido-5,7-dichloro-6-hydroxy-1-benzothiophene-3-carboxamide (PubChem CID 118975317) has the molecular formula C11H8Cl2N2O3S and a molecular weight of 319.17 g/mol. Its IUPAC name is 2-acetamido-5,7-dichloro-6-hydroxy-1-benzothiophene-3-carboxamide.
| Compound Name | 2-acetamido-5,7-dichloro-6-hydroxy-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 118975317 |
| Molecular Formula | C11H8Cl2N2O3S |
| Molecular Weight | 319.17 g/mol |
| Exact Mass | 317.96 |
| IUPAC Name | 2-acetamido-5,7-dichloro-6-hydroxy-1-benzothiophene-3-carboxamide |
| SMILES | CC(=O)Nc1sc2c(Cl)c(O)c(Cl)cc2c1C(N)=O |
| InChI | InChI=1S/C11H8Cl2N2O3S/c1-3(16)15-11-6(10(14)18)4-2-5(12)8(17)7(13)9(4)19-11/h2,17H,1H3,(H2,14,18)(H,15,16) |
| InChIKey | NNVNMIKLGNRPIF-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.17 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |