C16H10ClFN2O3S — CID 69449677
7-chloro-2-[(3-fluorobenzoyl)amino]-6-hydroxy-1-benzothiophene-3-carboxamide (PubChem CID 69449677) has the molecular formula C16H10ClFN2O3S and a molecular weight of 364.79 g/mol. Its IUPAC name is 7-chloro-2-[(3-fluorobenzoyl)amino]-6-hydroxy-1-benzothiophene-3-carboxamide.
| Compound Name | 7-chloro-2-[(3-fluorobenzoyl)amino]-6-hydroxy-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 69449677 |
| Molecular Formula | C16H10ClFN2O3S |
| Molecular Weight | 364.79 g/mol |
| Exact Mass | 364.01 |
| IUPAC Name | 7-chloro-2-[(3-fluorobenzoyl)amino]-6-hydroxy-1-benzothiophene-3-carboxamide |
| SMILES | NC(=O)c1c(NC(=O)c2cccc(F)c2)sc2c(Cl)c(O)ccc12 |
| InChI | InChI=1S/C16H10ClFN2O3S/c17-12-10(21)5-4-9-11(14(19)22)16(24-13(9)12)20-15(23)7-2-1-3-8(18)6-7/h1-6,21H,(H2,19,22)(H,20,23) |
| InChIKey | CWMLENLLUXRSLN-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.79 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |