About 5,7-dichloro-6-hydroxy-2-(methylamino)-1-benzothiophene-3-carboxamide;methanol
5,7-dichloro-6-hydroxy-2-(methylamino)-1-benzothiophene-3-carboxamide;methanol (PubChem CID 145365471) has the molecular formula C11H12Cl2N2O3S
and a molecular weight of 323.20 g/mol. Its IUPAC name is 5,7-dichloro-6-hydroxy-2-(methylamino)-1-benzothiophene-3-carboxamide;methanol.
Molecular Properties
| Compound Name | 5,7-dichloro-6-hydroxy-2-(methylamino)-1-benzothiophene-3-carboxamide;methanol |
| PubChem CID | 145365471 |
| Molecular Formula | C11H12Cl2N2O3S |
| Molecular Weight | 323.20 g/mol |
| Exact Mass | 321.99 |
| IUPAC Name | 5,7-dichloro-6-hydroxy-2-(methylamino)-1-benzothiophene-3-carboxamide;methanol |
| SMILES | CNc1sc2c(Cl)c(O)c(Cl)cc2c1C(N)=O.CO |
| InChI | InChI=1S/C10H8Cl2N2O2S.CH4O/c1-14-10-5(9(13)16)3-2-4(11)7(15)6(12)8(3)17-10;1-2/h2,14-15H,1H3,(H2,13,16);2H,1H3 |
| InChIKey | NWAYGPRJVIHTPM-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.20 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5,7-dichloro-6-hydroxy-2-(methylamino)-1-benzothiophene-3-carboxamide;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dichloro-6-hydroxy-2-(methylamino)-1-benzothiophene-3-carboxamide;methanol?
The IUPAC name of 5,7-dichloro-6-hydroxy-2-(methylamino)-1-benzothiophene-3-carboxamide;methanol (CID 145365471) is 5,7-dichloro-6-hydroxy-2-(methylamino)-1-benzothiophene-3-carboxamide;methanol.
What is the SMILES notation for 5,7-dichloro-6-hydroxy-2-(methylamino)-1-benzothiophene-3-carboxamide;methanol?
The canonical SMILES for 5,7-dichloro-6-hydroxy-2-(methylamino)-1-benzothiophene-3-carboxamide;methanol is CNc1sc2c(Cl)c(O)c(Cl)cc2c1C(N)=O.CO.
What is the InChIKey of 5,7-dichloro-6-hydroxy-2-(methylamino)-1-benzothiophene-3-carboxamide;methanol?
The InChIKey is NWAYGPRJVIHTPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8Cl2N2O2S.CH4O/c1-14-10-5(9(13)16)3-2-4(11)7(15)6(12)8(3)17-10;1-2/h2,14-15H,1H3,(H2,13,16);2H,1H3.
What are the key properties of 5,7-dichloro-6-hydroxy-2-(methylamino)-1-benzothiophene-3-carboxamide;methanol?
5,7-dichloro-6-hydroxy-2-(methylamino)-1-benzothiophene-3-carboxamide;methanol has a molecular weight of 323.20 g/mol, XLogP of 2.66, 2 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dichloro-6-hydroxy-2-(methylamino)-1-benzothiophene-3-carboxamide;methanol is sourced from PubChem (CID 145365471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).