C16H12F3NO — CID 118982278
3-[[4-(trifluoromethyl)phenyl]methyl]-2H-1,4-benzoxazine (PubChem CID 118982278) has the molecular formula C16H12F3NO and a molecular weight of 291.27 g/mol. Its IUPAC name is 3-[[4-(trifluoromethyl)phenyl]methyl]-2H-1,4-benzoxazine.
| Compound Name | 3-[[4-(trifluoromethyl)phenyl]methyl]-2H-1,4-benzoxazine |
|---|---|
| PubChem CID | 118982278 |
| Molecular Formula | C16H12F3NO |
| Molecular Weight | 291.27 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 3-[[4-(trifluoromethyl)phenyl]methyl]-2H-1,4-benzoxazine |
| SMILES | FC(F)(F)c1ccc(CC2=Nc3ccccc3OC2)cc1 |
| InChI | InChI=1S/C16H12F3NO/c17-16(18,19)12-7-5-11(6-8-12)9-13-10-21-15-4-2-1-3-14(15)20-13/h1-8H,9-10H2 |
| InChIKey | OCRZLRNMJWKGOH-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.27 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |