C40H59N5+2 — CID 118983478
3-[4-[[4-(dihexylamino)naphthalen-1-yl]diazenyl]quinolin-1-ium-1-yl]propyl-triethylazanium (PubChem CID 118983478) has the molecular formula C40H59N5+2 and a molecular weight of 609.95 g/mol. Its IUPAC name is 3-[4-[[4-(dihexylamino)naphthalen-1-yl]diazenyl]quinolin-1-ium-1-yl]propyl-triethylazanium.
| Compound Name | 3-[4-[[4-(dihexylamino)naphthalen-1-yl]diazenyl]quinolin-1-ium-1-yl]propyl-triethylazanium |
|---|---|
| PubChem CID | 118983478 |
| Molecular Formula | C40H59N5+2 |
| Molecular Weight | 609.95 g/mol |
| Exact Mass | 609.48 |
| IUPAC Name | 3-[4-[[4-(dihexylamino)naphthalen-1-yl]diazenyl]quinolin-1-ium-1-yl]propyl-triethylazanium |
| SMILES | CCCCCCN(CCCCCC)c1ccc(/N=N/c2cc[n+](CCC[N+](CC)(CC)CC)c3ccccc23)c2ccccc12 |
| InChI | InChI=1S/C40H59N5/c1-6-11-13-19-29-43(30-20-14-12-7-2)40-27-26-37(34-22-15-16-23-35(34)40)41-42-38-28-32-44(39-25-18-17-24-36(38)39)31-21-33-45(8-3,9-4)10-5/h15-18,22-28,32H,6-14,19-21,29-31,33H2,1-5H3/q+2 |
| InChIKey | HUQWBLAQMZOVHK-UHFFFAOYSA-N |
| XLogP | 10.93 |
| TPSA | 31.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.95 |
| LogP ≤ 5 | 10.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|