C10H9ClN4OS — CID 118983742
4-amino-N-(2-chloro-5-methylphenyl)-1,2,5-oxadiazole-3-carbothioamide (PubChem CID 118983742) has the molecular formula C10H9ClN4OS and a molecular weight of 268.73 g/mol. Its IUPAC name is 4-amino-N-(2-chloro-5-methylphenyl)-1,2,5-oxadiazole-3-carbothioamide.
| Compound Name | 4-amino-N-(2-chloro-5-methylphenyl)-1,2,5-oxadiazole-3-carbothioamide |
|---|---|
| PubChem CID | 118983742 |
| Molecular Formula | C10H9ClN4OS |
| Molecular Weight | 268.73 g/mol |
| Exact Mass | 268.02 |
| IUPAC Name | 4-amino-N-(2-chloro-5-methylphenyl)-1,2,5-oxadiazole-3-carbothioamide |
| SMILES | Cc1ccc(Cl)c(NC(=S)c2nonc2N)c1 |
| InChI | InChI=1S/C10H9ClN4OS/c1-5-2-3-6(11)7(4-5)13-10(17)8-9(12)15-16-14-8/h2-4H,1H3,(H2,12,15)(H,13,17) |
| InChIKey | GLIWRFCWXVGDHO-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 76.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.73 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|