C9H6Cl2N4OS — CID 58558194
4-amino-N-(2,5-dichlorophenyl)-1,2,5-oxadiazole-3-carbothioamide (PubChem CID 58558194) has the molecular formula C9H6Cl2N4OS and a molecular weight of 289.15 g/mol. Its IUPAC name is 4-amino-N-(2,5-dichlorophenyl)-1,2,5-oxadiazole-3-carbothioamide.
| Compound Name | 4-amino-N-(2,5-dichlorophenyl)-1,2,5-oxadiazole-3-carbothioamide |
|---|---|
| PubChem CID | 58558194 |
| Molecular Formula | C9H6Cl2N4OS |
| Molecular Weight | 289.15 g/mol |
| Exact Mass | 287.96 |
| IUPAC Name | 4-amino-N-(2,5-dichlorophenyl)-1,2,5-oxadiazole-3-carbothioamide |
| SMILES | Nc1nonc1C(=S)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C9H6Cl2N4OS/c10-4-1-2-5(11)6(3-4)13-9(17)7-8(12)15-16-14-7/h1-3H,(H2,12,15)(H,13,17) |
| InChIKey | HSNKJYVTUSOQFQ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 76.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.15 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|