About (2,5-diiodophenyl)hydrazine
(2,5-diiodophenyl)hydrazine (PubChem CID 118990861) has the molecular formula C6H6I2N2
and a molecular weight of 359.94 g/mol. Its IUPAC name is (2,5-diiodophenyl)hydrazine.
Molecular Properties
| Compound Name | (2,5-diiodophenyl)hydrazine |
| PubChem CID | 118990861 |
| Molecular Formula | C6H6I2N2 |
| Molecular Weight | 359.94 g/mol |
| Exact Mass | 359.86 |
| IUPAC Name | (2,5-diiodophenyl)hydrazine |
| SMILES | NNc1cc(I)ccc1I |
| InChI | InChI=1S/C6H6I2N2/c7-4-1-2-5(8)6(3-4)10-9/h1-3,10H,9H2 |
| InChIKey | UEFGZIZVAHJAFU-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.94 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2,5-diiodophenyl)hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-diiodophenyl)hydrazine?
The IUPAC name of (2,5-diiodophenyl)hydrazine (CID 118990861) is (2,5-diiodophenyl)hydrazine.
What is the SMILES notation for (2,5-diiodophenyl)hydrazine?
The canonical SMILES for (2,5-diiodophenyl)hydrazine is NNc1cc(I)ccc1I.
What is the InChIKey of (2,5-diiodophenyl)hydrazine?
The InChIKey is UEFGZIZVAHJAFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6I2N2/c7-4-1-2-5(8)6(3-4)10-9/h1-3,10H,9H2.
What are the key properties of (2,5-diiodophenyl)hydrazine?
(2,5-diiodophenyl)hydrazine has a molecular weight of 359.94 g/mol, XLogP of 2.18, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-diiodophenyl)hydrazine is sourced from PubChem (CID 118990861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).