C19H24NO4- — CID 11899958
(1R,5S,6R,7S)-4-oxo-3-[[(1R,2R,6R)-2,4,6-trimethylcyclohex-3-en-1-yl]methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylate (PubChem CID 11899958) has the molecular formula C19H24NO4- and a molecular weight of 330.40 g/mol. Its IUPAC name is (1R,5S,6R,7S)-4-oxo-3-[[(1R,2R,6R)-2,4,6-trimethylcyclohex-3-en-1-yl]methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylate.
| Compound Name | (1R,5S,6R,7S)-4-oxo-3-[[(1R,2R,6R)-2,4,6-trimethylcyclohex-3-en-1-yl]methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylate |
|---|---|
| PubChem CID | 11899958 |
| Molecular Formula | C19H24NO4- |
| Molecular Weight | 330.40 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | (1R,5S,6R,7S)-4-oxo-3-[[(1R,2R,6R)-2,4,6-trimethylcyclohex-3-en-1-yl]methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylate |
| SMILES | CC1=C[C@@H](C)[C@H](CN2C[C@]34C=C[C@H](O3)[C@H](C(=O)[O-])[C@@H]4C2=O)[C@H](C)C1 |
| InChI | InChI=1S/C19H25NO4/c1-10-6-11(2)13(12(3)7-10)8-20-9-19-5-4-14(24-19)15(18(22)23)16(19)17(20)21/h4-6,11-16H,7-9H2,1-3H3,(H,22,23)/p-1/t11-,12-,13+,14+,15+,16-,19+/m1/s1 |
| InChIKey | AVEIOIMSQGNDBX-QLIBCAGHSA-M |
| XLogP | 0.76 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.40 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|