C7H8F2N2O2 — CID 119007455
6-amino-2-(difluoromethyl)-5-methoxypyridin-3-ol (PubChem CID 119007455) has the molecular formula C7H8F2N2O2 and a molecular weight of 190.15 g/mol. Its IUPAC name is 6-amino-2-(difluoromethyl)-5-methoxypyridin-3-ol.
| Compound Name | 6-amino-2-(difluoromethyl)-5-methoxypyridin-3-ol |
|---|---|
| PubChem CID | 119007455 |
| Molecular Formula | C7H8F2N2O2 |
| Molecular Weight | 190.15 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | 6-amino-2-(difluoromethyl)-5-methoxypyridin-3-ol |
| SMILES | COc1cc(O)c(C(F)F)nc1N |
| InChI | InChI=1S/C7H8F2N2O2/c1-13-4-2-3(12)5(6(8)9)11-7(4)10/h2,6,12H,1H3,(H2,10,11) |
| InChIKey | XJCYQCIIGASDIE-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 68.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.15 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |