C6H4Br3NO2S — CID 119009314
2,3,5-tribromobenzenesulfonamide (PubChem CID 119009314) has the molecular formula C6H4Br3NO2S and a molecular weight of 393.88 g/mol. Its IUPAC name is 2,3,5-tribromobenzenesulfonamide.
| Compound Name | 2,3,5-tribromobenzenesulfonamide |
|---|---|
| PubChem CID | 119009314 |
| Molecular Formula | C6H4Br3NO2S |
| Molecular Weight | 393.88 g/mol |
| Exact Mass | 390.75 |
| IUPAC Name | 2,3,5-tribromobenzenesulfonamide |
| SMILES | NS(=O)(=O)c1cc(Br)cc(Br)c1Br |
| InChI | InChI=1S/C6H4Br3NO2S/c7-3-1-4(8)6(9)5(2-3)13(10,11)12/h1-2H,(H2,10,11,12) |
| InChIKey | UGYKSACCMLLBMK-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.88 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|