C14H16N2O2 — CID 11901281
[(2R,3R)-2,3-dimethyloxiran-2-yl]-[(4S)-4-phenyl-4,5-dihydro-1H-pyrazol-3-yl]methanone (PubChem CID 11901281) has the molecular formula C14H16N2O2 and a molecular weight of 244.29 g/mol. Its IUPAC name is [(2R,3R)-2,3-dimethyloxiran-2-yl]-[(4S)-4-phenyl-4,5-dihydro-1H-pyrazol-3-yl]methanone.
| Compound Name | [(2R,3R)-2,3-dimethyloxiran-2-yl]-[(4S)-4-phenyl-4,5-dihydro-1H-pyrazol-3-yl]methanone |
|---|---|
| PubChem CID | 11901281 |
| Molecular Formula | C14H16N2O2 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | [(2R,3R)-2,3-dimethyloxiran-2-yl]-[(4S)-4-phenyl-4,5-dihydro-1H-pyrazol-3-yl]methanone |
| SMILES | C[C@H]1O[C@@]1(C)C(=O)C1=NNC[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C14H16N2O2/c1-9-14(2,18-9)13(17)12-11(8-15-16-12)10-6-4-3-5-7-10/h3-7,9,11,15H,8H2,1-2H3/t9-,11-,14-/m1/s1 |
| InChIKey | QZEOHVOTGGMHDI-GLXFQSAKSA-N |
| XLogP | 1.48 |
| TPSA | 53.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|