C15H16N2O2S — CID 11902648
(1S,2R,6R,7R)-10-propan-2-ylidene-4-(1,3-thiazol-2-yl)-4-azatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 11902648) has the molecular formula C15H16N2O2S and a molecular weight of 288.37 g/mol. Its IUPAC name is (1S,2R,6R,7R)-10-propan-2-ylidene-4-(1,3-thiazol-2-yl)-4-azatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | (1S,2R,6R,7R)-10-propan-2-ylidene-4-(1,3-thiazol-2-yl)-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 11902648 |
| Molecular Formula | C15H16N2O2S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | (1S,2R,6R,7R)-10-propan-2-ylidene-4-(1,3-thiazol-2-yl)-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | CC(C)=C1[C@H]2CC[C@@H]1[C@H]1C(=O)N(c3nccs3)C(=O)[C@@H]12 |
| InChI | InChI=1S/C15H16N2O2S/c1-7(2)10-8-3-4-9(10)12-11(8)13(18)17(14(12)19)15-16-5-6-20-15/h5-6,8-9,11-12H,3-4H2,1-2H3/t8-,9+,11-,12-/m1/s1 |
| InChIKey | ORKRBMWSAFGMBZ-RBLKWDMZSA-N |
| XLogP | 2.62 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|