C9H13N3O2S — CID 20590208
6-(methylamino)-4-(1,3-thiazol-2-yl)-1,4-oxazepan-5-one (PubChem CID 20590208) has the molecular formula C9H13N3O2S and a molecular weight of 227.29 g/mol. Its IUPAC name is 6-(methylamino)-4-(1,3-thiazol-2-yl)-1,4-oxazepan-5-one.
| Compound Name | 6-(methylamino)-4-(1,3-thiazol-2-yl)-1,4-oxazepan-5-one |
|---|---|
| PubChem CID | 20590208 |
| Molecular Formula | C9H13N3O2S |
| Molecular Weight | 227.29 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | 6-(methylamino)-4-(1,3-thiazol-2-yl)-1,4-oxazepan-5-one |
| SMILES | CNC1COCCN(c2nccs2)C1=O |
| InChI | InChI=1S/C9H13N3O2S/c1-10-7-6-14-4-3-12(8(7)13)9-11-2-5-15-9/h2,5,7,10H,3-4,6H2,1H3 |
| InChIKey | HVGWJWFOAMCNDT-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.29 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |