C10H14N4O2 — CID 20590202
6-(methylamino)-4-pyrazin-2-yl-1,4-oxazepan-5-one (PubChem CID 20590202) has the molecular formula C10H14N4O2 and a molecular weight of 222.25 g/mol. Its IUPAC name is 6-(methylamino)-4-pyrazin-2-yl-1,4-oxazepan-5-one.
| Compound Name | 6-(methylamino)-4-pyrazin-2-yl-1,4-oxazepan-5-one |
|---|---|
| PubChem CID | 20590202 |
| Molecular Formula | C10H14N4O2 |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | 6-(methylamino)-4-pyrazin-2-yl-1,4-oxazepan-5-one |
| SMILES | CNC1COCCN(c2cnccn2)C1=O |
| InChI | InChI=1S/C10H14N4O2/c1-11-8-7-16-5-4-14(10(8)15)9-6-12-2-3-13-9/h2-3,6,8,11H,4-5,7H2,1H3 |
| InChIKey | IEJMPUHZRRQLKD-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |