2,2-difluoro-2-(5-propan-2-yl-1H-pyrazol-3-yl)ethanamine

C8H13F2N3 — CID 119031272

IUPAC2,2-difluoro-2-(5-propan-2-yl-1H-pyrazol-3-yl)ethanamine
SMILESCC(C)c1cc(C(F)(F)CN)n[nH]1
InChIInChI=1S/C8H13F2N3/c1-5(2)6-3-7(13-12-6)8(9,10)4-11/h3,5H,4,11H2,1-2H3,(H,12,13)
InChIKeyKUXKBZKRYMNXRU-UHFFFAOYSA-N
MW189.21 g/mol
LogP1.58
Rot. Bonds3

About 2,2-difluoro-2-(5-propan-2-yl-1H-pyrazol-3-yl)ethanamine

2,2-difluoro-2-(5-propan-2-yl-1H-pyrazol-3-yl)ethanamine (PubChem CID 119031272) has the molecular formula C8H13F2N3 and a molecular weight of 189.21 g/mol. Its IUPAC name is 2,2-difluoro-2-(5-propan-2-yl-1H-pyrazol-3-yl)ethanamine.

Molecular Properties

Compound Name2,2-difluoro-2-(5-propan-2-yl-1H-pyrazol-3-yl)ethanamine
PubChem CID119031272
Molecular FormulaC8H13F2N3
Molecular Weight189.21 g/mol
Exact Mass189.11
IUPAC Name2,2-difluoro-2-(5-propan-2-yl-1H-pyrazol-3-yl)ethanamine
SMILESCC(C)c1cc(C(F)(F)CN)n[nH]1
InChIInChI=1S/C8H13F2N3/c1-5(2)6-3-7(13-12-6)8(9,10)4-11/h3,5H,4,11H2,1-2H3,(H,12,13)
InChIKeyKUXKBZKRYMNXRU-UHFFFAOYSA-N
XLogP1.58
TPSA54.70 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500189.21
LogP ≤ 51.58
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2,2-difluoro-2-(5-propan-2-yl-1H-pyrazol-3-yl)ethanamine with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

CID 600756
CID 600756
CID 136912
CID 136912
CID 6485300
CID 6485300
CID 7147403
CID 7147403
CID 4306367
CID 4306367
CID 5255229
CID 5255229
CID 7147438
CID 7147438
CID 23006039
CID 23006039
CID 44236867
CID 44236867
CID 2774945
CID 2774945
CID 2776179
CID 2776179
CID 2776343
CID 2776343

Frequently Asked Questions

What is the IUPAC name of 2,2-difluoro-2-(5-propan-2-yl-1H-pyrazol-3-yl)ethanamine?
The IUPAC name of 2,2-difluoro-2-(5-propan-2-yl-1H-pyrazol-3-yl)ethanamine (CID 119031272) is 2,2-difluoro-2-(5-propan-2-yl-1H-pyrazol-3-yl)ethanamine.
What is the SMILES notation for 2,2-difluoro-2-(5-propan-2-yl-1H-pyrazol-3-yl)ethanamine?
The canonical SMILES for 2,2-difluoro-2-(5-propan-2-yl-1H-pyrazol-3-yl)ethanamine is CC(C)c1cc(C(F)(F)CN)n[nH]1.
What is the InChIKey of 2,2-difluoro-2-(5-propan-2-yl-1H-pyrazol-3-yl)ethanamine?
The InChIKey is KUXKBZKRYMNXRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13F2N3/c1-5(2)6-3-7(13-12-6)8(9,10)4-11/h3,5H,4,11H2,1-2H3,(H,12,13).
What are the key properties of 2,2-difluoro-2-(5-propan-2-yl-1H-pyrazol-3-yl)ethanamine?
2,2-difluoro-2-(5-propan-2-yl-1H-pyrazol-3-yl)ethanamine has a molecular weight of 189.21 g/mol, XLogP of 1.58, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-difluoro-2-(5-propan-2-yl-1H-pyrazol-3-yl)ethanamine is sourced from PubChem (CID 119031272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).