C10H20O2 — CID 119031559
cis-(1R,2S)-2-(2-hydroxy-2-methylpropyl)cyclohexan-1-ol (PubChem CID 119031559) has the molecular formula C10H20O2 and a molecular weight of 172.27 g/mol. Its IUPAC name is cis-(1R,2S)-2-(2-hydroxy-2-methylpropyl)cyclohexan-1-ol.
| Compound Name | cis-(1R,2S)-2-(2-hydroxy-2-methylpropyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 119031559 |
| Molecular Formula | C10H20O2 |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.15 |
| IUPAC Name | cis-(1R,2S)-2-(2-hydroxy-2-methylpropyl)cyclohexan-1-ol |
| SMILES | CC(C)(O)C[C@@H]1CCCC[C@H]1O |
| InChI | InChI=1S/C10H20O2/c1-10(2,12)7-8-5-3-4-6-9(8)11/h8-9,11-12H,3-7H2,1-2H3/t8-,9+/m0/s1 |
| InChIKey | BFCQCRWHZVSGFL-DTWKUNHWSA-N |
| XLogP | 1.70 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |