C9H20NO+ — CID 7360395
[(1R,2R)-2-hydroxycyclohexyl]methyl-dimethylazanium (PubChem CID 7360395) has the molecular formula C9H20NO+ and a molecular weight of 158.27 g/mol. Its IUPAC name is [(1R,2R)-2-hydroxycyclohexyl]methyl-dimethylazanium.
| Compound Name | [(1R,2R)-2-hydroxycyclohexyl]methyl-dimethylazanium |
|---|---|
| PubChem CID | 7360395 |
| Molecular Formula | C9H20NO+ |
| Molecular Weight | 158.27 g/mol |
| Exact Mass | 158.15 |
| IUPAC Name | [(1R,2R)-2-hydroxycyclohexyl]methyl-dimethylazanium |
| SMILES | C[NH+](C)C[C@H]1CCCC[C@H]1O |
| InChI | InChI=1S/C9H19NO/c1-10(2)7-8-5-3-4-6-9(8)11/h8-9,11H,3-7H2,1-2H3/p+1/t8-,9-/m1/s1 |
| InChIKey | LBKGSNPSDIYPBE-RKDXNWHRSA-O |
| XLogP | -0.32 |
| TPSA | 24.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.27 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |