C15H14N2O7S — CID 119034124
4-hydroxy-N-(4-hydroxy-3,4-dihydro-2H-chromen-8-yl)-3-nitrobenzenesulfonamide (PubChem CID 119034124) has the molecular formula C15H14N2O7S and a molecular weight of 366.35 g/mol. Its IUPAC name is 4-hydroxy-N-(4-hydroxy-3,4-dihydro-2H-chromen-8-yl)-3-nitrobenzenesulfonamide.
| Compound Name | 4-hydroxy-N-(4-hydroxy-3,4-dihydro-2H-chromen-8-yl)-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 119034124 |
| Molecular Formula | C15H14N2O7S |
| Molecular Weight | 366.35 g/mol |
| Exact Mass | 366.05 |
| IUPAC Name | 4-hydroxy-N-(4-hydroxy-3,4-dihydro-2H-chromen-8-yl)-3-nitrobenzenesulfonamide |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)Nc2cccc3c2OCCC3O)ccc1O |
| InChI | InChI=1S/C15H14N2O7S/c18-13-6-7-24-15-10(13)2-1-3-11(15)16-25(22,23)9-4-5-14(19)12(8-9)17(20)21/h1-5,8,13,16,18-19H,6-7H2 |
| InChIKey | ITHFMIHWZMFDJA-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 139.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.35 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|