About N-(4-hydroxy-3,4-dihydro-2H-chromen-8-yl)-1-(2-methoxyethyl)pyrazole-4-sulfonamide
N-(4-hydroxy-3,4-dihydro-2H-chromen-8-yl)-1-(2-methoxyethyl)pyrazole-4-sulfonamide (PubChem CID 126805654) has the molecular formula C15H19N3O5S
and a molecular weight of 353.40 g/mol. Its IUPAC name is N-(4-hydroxy-3,4-dihydro-2H-chromen-8-yl)-1-(2-methoxyethyl)pyrazole-4-sulfonamide.
Molecular Properties
| Compound Name | N-(4-hydroxy-3,4-dihydro-2H-chromen-8-yl)-1-(2-methoxyethyl)pyrazole-4-sulfonamide |
| PubChem CID | 126805654 |
| Molecular Formula | C15H19N3O5S |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | N-(4-hydroxy-3,4-dihydro-2H-chromen-8-yl)-1-(2-methoxyethyl)pyrazole-4-sulfonamide |
| SMILES | COCCn1cc(S(=O)(=O)Nc2cccc3c2OCCC3O)cn1 |
| InChI | InChI=1S/C15H19N3O5S/c1-22-8-6-18-10-11(9-16-18)24(20,21)17-13-4-2-3-12-14(19)5-7-23-15(12)13/h2-4,9-10,14,17,19H,5-8H2,1H3 |
| InChIKey | CCKBWKVHGBKZII-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-(4-hydroxy-3,4-dihydro-2H-chromen-8-yl)-1-(2-methoxyethyl)pyrazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-hydroxy-3,4-dihydro-2H-chromen-8-yl)-1-(2-methoxyethyl)pyrazole-4-sulfonamide?
The IUPAC name of N-(4-hydroxy-3,4-dihydro-2H-chromen-8-yl)-1-(2-methoxyethyl)pyrazole-4-sulfonamide (CID 126805654) is N-(4-hydroxy-3,4-dihydro-2H-chromen-8-yl)-1-(2-methoxyethyl)pyrazole-4-sulfonamide.
What is the SMILES notation for N-(4-hydroxy-3,4-dihydro-2H-chromen-8-yl)-1-(2-methoxyethyl)pyrazole-4-sulfonamide?
The canonical SMILES for N-(4-hydroxy-3,4-dihydro-2H-chromen-8-yl)-1-(2-methoxyethyl)pyrazole-4-sulfonamide is COCCn1cc(S(=O)(=O)Nc2cccc3c2OCCC3O)cn1.
What is the InChIKey of N-(4-hydroxy-3,4-dihydro-2H-chromen-8-yl)-1-(2-methoxyethyl)pyrazole-4-sulfonamide?
The InChIKey is CCKBWKVHGBKZII-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N3O5S/c1-22-8-6-18-10-11(9-16-18)24(20,21)17-13-4-2-3-12-14(19)5-7-23-15(12)13/h2-4,9-10,14,17,19H,5-8H2,1H3.
What are the key properties of N-(4-hydroxy-3,4-dihydro-2H-chromen-8-yl)-1-(2-methoxyethyl)pyrazole-4-sulfonamide?
N-(4-hydroxy-3,4-dihydro-2H-chromen-8-yl)-1-(2-methoxyethyl)pyrazole-4-sulfonamide has a molecular weight of 353.40 g/mol, XLogP of 1.15, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-hydroxy-3,4-dihydro-2H-chromen-8-yl)-1-(2-methoxyethyl)pyrazole-4-sulfonamide is sourced from PubChem (CID 126805654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).